About [3-[(3-amino-4-chlorobenzoyl)oxymethyl]phenyl]methyl 3-amino-4-chlorobenzoate
[3-[(3-amino-4-chlorobenzoyl)oxymethyl]phenyl]methyl 3-amino-4-chlorobenzoate (PubChem CID 16578140) has the molecular formula C22H18Cl2N2O4
and a molecular weight of 445.30 g/mol. Its IUPAC name is [3-[(3-amino-4-chlorobenzoyl)oxymethyl]phenyl]methyl 3-amino-4-chlorobenzoate.
Molecular Properties
| Compound Name | [3-[(3-amino-4-chlorobenzoyl)oxymethyl]phenyl]methyl 3-amino-4-chlorobenzoate |
| PubChem CID | 16578140 |
| Molecular Formula | C22H18Cl2N2O4 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | [3-[(3-amino-4-chlorobenzoyl)oxymethyl]phenyl]methyl 3-amino-4-chlorobenzoate |
| SMILES | Nc1cc(C(=O)OCc2cccc(COC(=O)c3ccc(Cl)c(N)c3)c2)ccc1Cl |
| InChI | InChI=1S/C22H18Cl2N2O4/c23-17-6-4-15(9-19(17)25)21(27)29-11-13-2-1-3-14(8-13)12-30-22(28)16-5-7-18(24)20(26)10-16/h1-10H,11-12,25-26H2 |
| InChIKey | VECDBWXFVVPUNL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [3-[(3-amino-4-chlorobenzoyl)oxymethyl]phenyl]methyl 3-amino-4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3-amino-4-chlorobenzoyl)oxymethyl]phenyl]methyl 3-amino-4-chlorobenzoate?
The IUPAC name of [3-[(3-amino-4-chlorobenzoyl)oxymethyl]phenyl]methyl 3-amino-4-chlorobenzoate (CID 16578140) is [3-[(3-amino-4-chlorobenzoyl)oxymethyl]phenyl]methyl 3-amino-4-chlorobenzoate.
What is the SMILES notation for [3-[(3-amino-4-chlorobenzoyl)oxymethyl]phenyl]methyl 3-amino-4-chlorobenzoate?
The canonical SMILES for [3-[(3-amino-4-chlorobenzoyl)oxymethyl]phenyl]methyl 3-amino-4-chlorobenzoate is Nc1cc(C(=O)OCc2cccc(COC(=O)c3ccc(Cl)c(N)c3)c2)ccc1Cl.
What is the InChIKey of [3-[(3-amino-4-chlorobenzoyl)oxymethyl]phenyl]methyl 3-amino-4-chlorobenzoate?
The InChIKey is VECDBWXFVVPUNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18Cl2N2O4/c23-17-6-4-15(9-19(17)25)21(27)29-11-13-2-1-3-14(8-13)12-30-22(28)16-5-7-18(24)20(26)10-16/h1-10H,11-12,25-26H2.
What are the key properties of [3-[(3-amino-4-chlorobenzoyl)oxymethyl]phenyl]methyl 3-amino-4-chlorobenzoate?
[3-[(3-amino-4-chlorobenzoyl)oxymethyl]phenyl]methyl 3-amino-4-chlorobenzoate has a molecular weight of 445.30 g/mol, XLogP of 4.87, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3-amino-4-chlorobenzoyl)oxymethyl]phenyl]methyl 3-amino-4-chlorobenzoate is sourced from PubChem (CID 16578140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).