About (5-chloro-2-fluorophenyl)methyl 3-amino-4-chlorobenzoate
(5-chloro-2-fluorophenyl)methyl 3-amino-4-chlorobenzoate (PubChem CID 103049371) has the molecular formula C14H10Cl2FNO2
and a molecular weight of 314.14 g/mol. Its IUPAC name is (5-chloro-2-fluorophenyl)methyl 3-amino-4-chlorobenzoate.
Molecular Properties
| Compound Name | (5-chloro-2-fluorophenyl)methyl 3-amino-4-chlorobenzoate |
| PubChem CID | 103049371 |
| Molecular Formula | C14H10Cl2FNO2 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | (5-chloro-2-fluorophenyl)methyl 3-amino-4-chlorobenzoate |
| SMILES | Nc1cc(C(=O)OCc2cc(Cl)ccc2F)ccc1Cl |
| InChI | InChI=1S/C14H10Cl2FNO2/c15-10-2-4-12(17)9(5-10)7-20-14(19)8-1-3-11(16)13(18)6-8/h1-6H,7,18H2 |
| InChIKey | FUOTXEAMGOOCFP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-2-fluorophenyl)methyl 3-amino-4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-2-fluorophenyl)methyl 3-amino-4-chlorobenzoate?
The IUPAC name of (5-chloro-2-fluorophenyl)methyl 3-amino-4-chlorobenzoate (CID 103049371) is (5-chloro-2-fluorophenyl)methyl 3-amino-4-chlorobenzoate.
What is the SMILES notation for (5-chloro-2-fluorophenyl)methyl 3-amino-4-chlorobenzoate?
The canonical SMILES for (5-chloro-2-fluorophenyl)methyl 3-amino-4-chlorobenzoate is Nc1cc(C(=O)OCc2cc(Cl)ccc2F)ccc1Cl.
What is the InChIKey of (5-chloro-2-fluorophenyl)methyl 3-amino-4-chlorobenzoate?
The InChIKey is FUOTXEAMGOOCFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2FNO2/c15-10-2-4-12(17)9(5-10)7-20-14(19)8-1-3-11(16)13(18)6-8/h1-6H,7,18H2.
What are the key properties of (5-chloro-2-fluorophenyl)methyl 3-amino-4-chlorobenzoate?
(5-chloro-2-fluorophenyl)methyl 3-amino-4-chlorobenzoate has a molecular weight of 314.14 g/mol, XLogP of 4.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-2-fluorophenyl)methyl 3-amino-4-chlorobenzoate is sourced from PubChem (CID 103049371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).