C24H14Br2Cl2O6 — CID 3112620
bis[2-(4-bromophenyl)-2-oxoethyl] 4,5-dichlorobenzene-1,2-dicarboxylate (PubChem CID 3112620) has the molecular formula C24H14Br2Cl2O6 and a molecular weight of 629.08 g/mol. Its IUPAC name is bis[2-(4-bromophenyl)-2-oxoethyl] 4,5-dichlorobenzene-1,2-dicarboxylate.
| Compound Name | bis[2-(4-bromophenyl)-2-oxoethyl] 4,5-dichlorobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 3112620 |
| Molecular Formula | C24H14Br2Cl2O6 |
| Molecular Weight | 629.08 g/mol |
| Exact Mass | 625.85 |
| IUPAC Name | bis[2-(4-bromophenyl)-2-oxoethyl] 4,5-dichlorobenzene-1,2-dicarboxylate |
| SMILES | O=C(COC(=O)c1cc(Cl)c(Cl)cc1C(=O)OCC(=O)c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H14Br2Cl2O6/c25-15-5-1-13(2-6-15)21(29)11-33-23(31)17-9-19(27)20(28)10-18(17)24(32)34-12-22(30)14-3-7-16(26)8-4-14/h1-10H,11-12H2 |
| InChIKey | IYRALZIJCXBBSZ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.08 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |