C24H15Br3O6 — CID 2728564
bis[2-(4-bromophenyl)-2-oxoethyl] 2-bromobenzene-1,3-dicarboxylate (PubChem CID 2728564) has the molecular formula C24H15Br3O6 and a molecular weight of 639.09 g/mol. Its IUPAC name is bis[2-(4-bromophenyl)-2-oxoethyl] 2-bromobenzene-1,3-dicarboxylate.
| Compound Name | bis[2-(4-bromophenyl)-2-oxoethyl] 2-bromobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 2728564 |
| Molecular Formula | C24H15Br3O6 |
| Molecular Weight | 639.09 g/mol |
| Exact Mass | 635.84 |
| IUPAC Name | bis[2-(4-bromophenyl)-2-oxoethyl] 2-bromobenzene-1,3-dicarboxylate |
| SMILES | O=C(COC(=O)c1cccc(C(=O)OCC(=O)c2ccc(Br)cc2)c1Br)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H15Br3O6/c25-16-8-4-14(5-9-16)20(28)12-32-23(30)18-2-1-3-19(22(18)27)24(31)33-13-21(29)15-6-10-17(26)11-7-15/h1-11H,12-13H2 |
| InChIKey | UDCFQDKEPUCFOE-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.09 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |