C15H9BrCl2O3 — CID 7873534
[2-(3-bromophenyl)-2-oxoethyl] 3,4-dichlorobenzoate (PubChem CID 7873534) has the molecular formula C15H9BrCl2O3 and a molecular weight of 388.04 g/mol. Its IUPAC name is [2-(3-bromophenyl)-2-oxoethyl] 3,4-dichlorobenzoate.
| Compound Name | [2-(3-bromophenyl)-2-oxoethyl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 7873534 |
| Molecular Formula | C15H9BrCl2O3 |
| Molecular Weight | 388.04 g/mol |
| Exact Mass | 385.91 |
| IUPAC Name | [2-(3-bromophenyl)-2-oxoethyl] 3,4-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)c(Cl)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H9BrCl2O3/c16-11-3-1-2-9(6-11)14(19)8-21-15(20)10-4-5-12(17)13(18)7-10/h1-7H,8H2 |
| InChIKey | CNMULIJODUUVFN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.04 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |