C22H15BrCl2O4 — CID 126186853
[2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[(4-bromophenoxy)methyl]benzoate (PubChem CID 126186853) has the molecular formula C22H15BrCl2O4 and a molecular weight of 494.17 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[(4-bromophenoxy)methyl]benzoate.
| Compound Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[(4-bromophenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 126186853 |
| Molecular Formula | C22H15BrCl2O4 |
| Molecular Weight | 494.17 g/mol |
| Exact Mass | 491.95 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[(4-bromophenoxy)methyl]benzoate |
| SMILES | O=C(COC(=O)c1ccc(COc2ccc(Br)cc2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H15BrCl2O4/c23-17-6-8-18(9-7-17)28-12-14-1-3-15(4-2-14)22(27)29-13-21(26)16-5-10-19(24)20(25)11-16/h1-11H,12-13H2 |
| InChIKey | XNHYFKGNLFKREI-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.17 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |