C20H23NO5S — CID 17460667
2-phenylethyl 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 17460667) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is 2-phenylethyl 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | 2-phenylethyl 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 17460667 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-phenylethyl 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | COc1ccc(C(=O)OCCc2ccccc2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C20H23NO5S/c1-25-18-10-9-17(15-19(18)27(23,24)21-12-5-6-13-21)20(22)26-14-11-16-7-3-2-4-8-16/h2-4,7-10,15H,5-6,11-14H2,1H3 |
| InChIKey | AEYAOBPKRNLWBV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |