C25H28FNO6S — CID 3667675
[2-(4-cyclohexylphenyl)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 3667675) has the molecular formula C25H28FNO6S and a molecular weight of 489.57 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 3667675 |
| Molecular Formula | C25H28FNO6S |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H28FNO6S/c26-22-11-10-21(16-24(22)34(30,31)27-12-14-32-15-13-27)25(29)33-17-23(28)20-8-6-19(7-9-20)18-4-2-1-3-5-18/h6-11,16,18H,1-5,12-15,17H2 |
| InChIKey | MNDMDQOPLWJPEV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |