C23H26FNO6S — CID 16521348
[2-(4-tert-butylphenyl)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 16521348) has the molecular formula C23H26FNO6S and a molecular weight of 463.53 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-(4-tert-butylphenyl)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16521348 |
| Molecular Formula | C23H26FNO6S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | [2-(4-tert-butylphenyl)-2-oxoethyl] 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)COC(=O)c2ccc(F)c(S(=O)(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C23H26FNO6S/c1-23(2,3)18-7-4-16(5-8-18)20(26)15-31-22(27)17-6-9-19(24)21(14-17)32(28,29)25-10-12-30-13-11-25/h4-9,14H,10-13,15H2,1-3H3 |
| InChIKey | KXSKXCNCEZJSPV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |