C17H23FN2O4S — CID 7964090
azepan-1-yl-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)methanone (PubChem CID 7964090) has the molecular formula C17H23FN2O4S and a molecular weight of 370.45 g/mol. Its IUPAC name is azepan-1-yl-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)methanone.
| Compound Name | azepan-1-yl-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 7964090 |
| Molecular Formula | C17H23FN2O4S |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | azepan-1-yl-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)methanone |
| SMILES | O=C(c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1)N1CCCCCC1 |
| InChI | InChI=1S/C17H23FN2O4S/c18-15-6-5-14(17(21)19-7-3-1-2-4-8-19)13-16(15)25(22,23)20-9-11-24-12-10-20/h5-6,13H,1-4,7-12H2 |
| InChIKey | NBJILCIUMBHUCA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |