C20H21FN2O6S — CID 55785896
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 55785896) has the molecular formula C20H21FN2O6S and a molecular weight of 436.46 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55785896 |
| Molecular Formula | C20H21FN2O6S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCCOc1ccc2c(c1)OCO2)c1ccc(F)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C20H21FN2O6S/c21-16-5-3-14(11-19(16)30(25,26)23-8-1-2-9-23)20(24)22-7-10-27-15-4-6-17-18(12-15)29-13-28-17/h3-6,11-12H,1-2,7-10,13H2,(H,22,24) |
| InChIKey | YHCFNSFOEPDJRA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|