C21H26FN3O6S2 — CID 30757530
4-fluoro-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 30757530) has the molecular formula C21H26FN3O6S2 and a molecular weight of 499.59 g/mol. Its IUPAC name is 4-fluoro-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-fluoro-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 30757530 |
| Molecular Formula | C21H26FN3O6S2 |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 4-fluoro-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNC(=O)c2ccc(F)c(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C21H26FN3O6S2/c1-31-17-6-8-18(9-7-17)32(27,28)24-12-11-23-21(26)16-5-10-19(22)20(15-16)33(29,30)25-13-3-2-4-14-25/h5-10,15,24H,2-4,11-14H2,1H3,(H,23,26) |
| InChIKey | NSMNLOURWRRGEP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|