C21H24FNO6S — CID 16528975
2-(4-methoxyphenoxy)ethyl 4-fluoro-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 16528975) has the molecular formula C21H24FNO6S and a molecular weight of 437.49 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)ethyl 4-fluoro-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | 2-(4-methoxyphenoxy)ethyl 4-fluoro-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16528975 |
| Molecular Formula | C21H24FNO6S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 2-(4-methoxyphenoxy)ethyl 4-fluoro-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | COc1ccc(OCCOC(=O)c2ccc(F)c(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C21H24FNO6S/c1-27-17-6-8-18(9-7-17)28-13-14-29-21(24)16-5-10-19(22)20(15-16)30(25,26)23-11-3-2-4-12-23/h5-10,15H,2-4,11-14H2,1H3 |
| InChIKey | JCRCRGZLJZCWNV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|