C20H24FNO6S — CID 16529915
2-(4-methoxyphenoxy)ethyl 3-(diethylsulfamoyl)-4-fluorobenzoate (PubChem CID 16529915) has the molecular formula C20H24FNO6S and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)ethyl 3-(diethylsulfamoyl)-4-fluorobenzoate.
| Compound Name | 2-(4-methoxyphenoxy)ethyl 3-(diethylsulfamoyl)-4-fluorobenzoate |
|---|---|
| PubChem CID | 16529915 |
| Molecular Formula | C20H24FNO6S |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 2-(4-methoxyphenoxy)ethyl 3-(diethylsulfamoyl)-4-fluorobenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCCOc2ccc(OC)cc2)ccc1F |
| InChI | InChI=1S/C20H24FNO6S/c1-4-22(5-2)29(24,25)19-14-15(6-11-18(19)21)20(23)28-13-12-27-17-9-7-16(26-3)8-10-17/h6-11,14H,4-5,12-13H2,1-3H3 |
| InChIKey | MAJVHALPIMKOJW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|