C22H26FNO5S — CID 16530056
[2-oxo-2-(4-propan-2-ylphenyl)ethyl] 3-(diethylsulfamoyl)-4-fluorobenzoate (PubChem CID 16530056) has the molecular formula C22H26FNO5S and a molecular weight of 435.52 g/mol. Its IUPAC name is [2-oxo-2-(4-propan-2-ylphenyl)ethyl] 3-(diethylsulfamoyl)-4-fluorobenzoate.
| Compound Name | [2-oxo-2-(4-propan-2-ylphenyl)ethyl] 3-(diethylsulfamoyl)-4-fluorobenzoate |
|---|---|
| PubChem CID | 16530056 |
| Molecular Formula | C22H26FNO5S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | [2-oxo-2-(4-propan-2-ylphenyl)ethyl] 3-(diethylsulfamoyl)-4-fluorobenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCC(=O)c2ccc(C(C)C)cc2)ccc1F |
| InChI | InChI=1S/C22H26FNO5S/c1-5-24(6-2)30(27,28)21-13-18(11-12-19(21)23)22(26)29-14-20(25)17-9-7-16(8-10-17)15(3)4/h7-13,15H,5-6,14H2,1-4H3 |
| InChIKey | LZYLFTXHWGNSMV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |