C17H23FN2O6S — CID 16530031
(2-morpholin-4-yl-2-oxoethyl) 3-(diethylsulfamoyl)-4-fluorobenzoate (PubChem CID 16530031) has the molecular formula C17H23FN2O6S and a molecular weight of 402.44 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 3-(diethylsulfamoyl)-4-fluorobenzoate.
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 3-(diethylsulfamoyl)-4-fluorobenzoate |
|---|---|
| PubChem CID | 16530031 |
| Molecular Formula | C17H23FN2O6S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 3-(diethylsulfamoyl)-4-fluorobenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCC(=O)N2CCOCC2)ccc1F |
| InChI | InChI=1S/C17H23FN2O6S/c1-3-20(4-2)27(23,24)15-11-13(5-6-14(15)18)17(22)26-12-16(21)19-7-9-25-10-8-19/h5-6,11H,3-4,7-10,12H2,1-2H3 |
| InChIKey | XSGASGIHHRNOGP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |