C21H25NO7S — CID 41072188
[2-(4-methoxyphenyl)-2-oxoethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate (PubChem CID 41072188) has the molecular formula C21H25NO7S and a molecular weight of 435.50 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 41072188 |
| Molecular Formula | C21H25NO7S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCC(=O)c2ccc(OC)cc2)ccc1OC |
| InChI | InChI=1S/C21H25NO7S/c1-5-22(6-2)30(25,26)20-13-16(9-12-19(20)28-4)21(24)29-14-18(23)15-7-10-17(27-3)11-8-15/h7-13H,5-6,14H2,1-4H3 |
| InChIKey | BBHSKSPAJGDJII-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |