C20H25N3O8S2 — CID 42981152
[2-oxo-2-(4-sulfamoylanilino)ethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate (PubChem CID 42981152) has the molecular formula C20H25N3O8S2 and a molecular weight of 499.57 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 42981152 |
| Molecular Formula | C20H25N3O8S2 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCC(=O)Nc2ccc(S(N)(=O)=O)cc2)ccc1OC |
| InChI | InChI=1S/C20H25N3O8S2/c1-4-23(5-2)33(28,29)18-12-14(6-11-17(18)30-3)20(25)31-13-19(24)22-15-7-9-16(10-8-15)32(21,26)27/h6-12H,4-5,13H2,1-3H3,(H,22,24)(H2,21,26,27) |
| InChIKey | XPZXYRYZBSPKFH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 162.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |