C22H27NO7S — CID 31197087
[2-(4-ethoxyphenyl)-2-oxoethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate (PubChem CID 31197087) has the molecular formula C22H27NO7S and a molecular weight of 449.53 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-2-oxoethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 31197087 |
| Molecular Formula | C22H27NO7S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate |
| SMILES | CCOc1ccc(C(=O)COC(=O)c2ccc(OC)c(S(=O)(=O)N(CC)CC)c2)cc1 |
| InChI | InChI=1S/C22H27NO7S/c1-5-23(6-2)31(26,27)21-14-17(10-13-20(21)28-4)22(25)30-15-19(24)16-8-11-18(12-9-16)29-7-3/h8-14H,5-7,15H2,1-4H3 |
| InChIKey | RPDVCJGZDKMPDM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |