C24H28N2O6S — CID 16512597
[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate (PubChem CID 16512597) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 16512597 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate |
| SMILES | CCc1cccc2c(C(=O)COC(=O)c3ccc(OC)c(S(=O)(=O)N(CC)CC)c3)c[nH]c12 |
| InChI | InChI=1S/C24H28N2O6S/c1-5-16-9-8-10-18-19(14-25-23(16)18)20(27)15-32-24(28)17-11-12-21(31-4)22(13-17)33(29,30)26(6-2)7-3/h8-14,25H,5-7,15H2,1-4H3 |
| InChIKey | YYHCNUYDBXQOCZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 105.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |