C22H23NO6 — CID 8015249
[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 2,3,4-trimethoxybenzoate (PubChem CID 8015249) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 2,3,4-trimethoxybenzoate.
| Compound Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 8015249 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 2,3,4-trimethoxybenzoate |
| SMILES | CCc1cccc2c(C(=O)COC(=O)c3ccc(OC)c(OC)c3OC)c[nH]c12 |
| InChI | InChI=1S/C22H23NO6/c1-5-13-7-6-8-14-16(11-23-19(13)14)17(24)12-29-22(25)15-9-10-18(26-2)21(28-4)20(15)27-3/h6-11,23H,5,12H2,1-4H3 |
| InChIKey | RQPZAUSKBXRTOF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |