C19H17NO4 — CID 7483516
[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 3-hydroxybenzoate (PubChem CID 7483516) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 3-hydroxybenzoate.
| Compound Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 3-hydroxybenzoate |
|---|---|
| PubChem CID | 7483516 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 3-hydroxybenzoate |
| SMILES | CCc1cccc2c(C(=O)COC(=O)c3cccc(O)c3)c[nH]c12 |
| InChI | InChI=1S/C19H17NO4/c1-2-12-5-4-8-15-16(10-20-18(12)15)17(22)11-24-19(23)13-6-3-7-14(21)9-13/h3-10,20-21H,2,11H2,1H3 |
| InChIKey | QMGKJAMFNBJFCH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |