C26H23NO4 — CID 8002292
[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 4-phenylmethoxybenzoate (PubChem CID 8002292) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 4-phenylmethoxybenzoate.
| Compound Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 8002292 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 4-phenylmethoxybenzoate |
| SMILES | CCc1cccc2c(C(=O)COC(=O)c3ccc(OCc4ccccc4)cc3)c[nH]c12 |
| InChI | InChI=1S/C26H23NO4/c1-2-19-9-6-10-22-23(15-27-25(19)22)24(28)17-31-26(29)20-11-13-21(14-12-20)30-16-18-7-4-3-5-8-18/h3-15,27H,2,16-17H2,1H3 |
| InChIKey | DYFOSYJWHAMXSJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |