C18H16N2O5 — CID 166212387
[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 5-carbamoylfuran-3-carboxylate (PubChem CID 166212387) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 5-carbamoylfuran-3-carboxylate.
| Compound Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 5-carbamoylfuran-3-carboxylate |
|---|---|
| PubChem CID | 166212387 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 5-carbamoylfuran-3-carboxylate |
| SMILES | CCc1cccc2c(C(=O)COC(=O)c3coc(C(N)=O)c3)c[nH]c12 |
| InChI | InChI=1S/C18H16N2O5/c1-2-10-4-3-5-12-13(7-20-16(10)12)14(21)9-25-18(23)11-6-15(17(19)22)24-8-11/h3-8,20H,2,9H2,1H3,(H2,19,22) |
| InChIKey | AUEPJYGEAYZTIT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |