C19H17ClN2O3 — CID 7873308
[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 2-amino-4-chlorobenzoate (PubChem CID 7873308) has the molecular formula C19H17ClN2O3 and a molecular weight of 356.81 g/mol. Its IUPAC name is [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 2-amino-4-chlorobenzoate.
| Compound Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 7873308 |
| Molecular Formula | C19H17ClN2O3 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 2-amino-4-chlorobenzoate |
| SMILES | CCc1cccc2c(C(=O)COC(=O)c3ccc(Cl)cc3N)c[nH]c12 |
| InChI | InChI=1S/C19H17ClN2O3/c1-2-11-4-3-5-13-15(9-22-18(11)13)17(23)10-25-19(24)14-7-6-12(20)8-16(14)21/h3-9,22H,2,10,21H2,1H3 |
| InChIKey | XCVHJCYVAQXRFK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|