C22H18ClN3O3 — CID 166376107
[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 1-(3-chlorophenyl)pyrazole-3-carboxylate (PubChem CID 166376107) has the molecular formula C22H18ClN3O3 and a molecular weight of 407.86 g/mol. Its IUPAC name is [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 1-(3-chlorophenyl)pyrazole-3-carboxylate.
| Compound Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 1-(3-chlorophenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 166376107 |
| Molecular Formula | C22H18ClN3O3 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 1-(3-chlorophenyl)pyrazole-3-carboxylate |
| SMILES | CCc1cccc2c(C(=O)COC(=O)c3ccn(-c4cccc(Cl)c4)n3)c[nH]c12 |
| InChI | InChI=1S/C22H18ClN3O3/c1-2-14-5-3-8-17-18(12-24-21(14)17)20(27)13-29-22(28)19-9-10-26(25-19)16-7-4-6-15(23)11-16/h3-12,24H,2,13H2,1H3 |
| InChIKey | XDPLRFURMJRAJZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |