C20H23N3O3 — CID 166338062
[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 1-tert-butylimidazole-4-carboxylate (PubChem CID 166338062) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 1-tert-butylimidazole-4-carboxylate.
| Compound Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 1-tert-butylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 166338062 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 1-tert-butylimidazole-4-carboxylate |
| SMILES | CCc1cccc2c(C(=O)COC(=O)c3cn(C(C)(C)C)cn3)c[nH]c12 |
| InChI | InChI=1S/C20H23N3O3/c1-5-13-7-6-8-14-15(9-21-18(13)14)17(24)11-26-19(25)16-10-23(12-22-16)20(2,3)4/h6-10,12,21H,5,11H2,1-4H3 |
| InChIKey | VJNHMHAHTCVWNY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |