C20H17N3O3 — CID 7649508
[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 1H-indazole-3-carboxylate (PubChem CID 7649508) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 1H-indazole-3-carboxylate.
| Compound Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 7649508 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 1H-indazole-3-carboxylate |
| SMILES | CCc1cccc2c(C(=O)COC(=O)c3n[nH]c4ccccc34)c[nH]c12 |
| InChI | InChI=1S/C20H17N3O3/c1-2-12-6-5-8-13-15(10-21-18(12)13)17(24)11-26-20(25)19-14-7-3-4-9-16(14)22-23-19/h3-10,21H,2,11H2,1H3,(H,22,23) |
| InChIKey | MXOPXZIPJMLWNB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |