C21H17Cl2NO3 — CID 7873987
[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 7873987) has the molecular formula C21H17Cl2NO3 and a molecular weight of 402.28 g/mol. Its IUPAC name is [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7873987 |
| Molecular Formula | C21H17Cl2NO3 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | CCc1cccc2c(C(=O)COC(=O)/C=C/c3ccc(Cl)cc3Cl)c[nH]c12 |
| InChI | InChI=1S/C21H17Cl2NO3/c1-2-13-4-3-5-16-17(11-24-21(13)16)19(25)12-27-20(26)9-7-14-6-8-15(22)10-18(14)23/h3-11,24H,2,12H2,1H3/b9-7+ |
| InChIKey | PMBOUTBCZYHAIX-VQHVLOKHSA-N |
| XLogP | 5.48 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|