C24H25NO6 — CID 8015241
[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 8015241) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8015241 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | CCc1cccc2c(C(=O)COC(=O)/C=C/c3cc(OC)c(OC)c(OC)c3)c[nH]c12 |
| InChI | InChI=1S/C24H25NO6/c1-5-16-7-6-8-17-18(13-25-23(16)17)19(26)14-31-22(27)10-9-15-11-20(28-2)24(30-4)21(12-15)29-3/h6-13,25H,5,14H2,1-4H3/b10-9+ |
| InChIKey | YUGJNOXOTTUIIT-MDZDMXLPSA-N |
| XLogP | 4.20 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|