C20H19FO6 — CID 2365432
[2-(4-fluorophenyl)-2-oxoethyl] (Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 2365432) has the molecular formula C20H19FO6 and a molecular weight of 374.36 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] (Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] (Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2365432 |
| Molecular Formula | C20H19FO6 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] (Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C\C(=O)OCC(=O)c2ccc(F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H19FO6/c1-24-17-10-13(11-18(25-2)20(17)26-3)4-9-19(23)27-12-16(22)14-5-7-15(21)8-6-14/h4-11H,12H2,1-3H3/b9-4- |
| InChIKey | UOXPIORXURWGBD-WTKPLQERSA-N |
| XLogP | 3.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|