C20H17ClF2O5 — CID 7683916
[2-(3,4-difluorophenyl)-2-oxoethyl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate (PubChem CID 7683916) has the molecular formula C20H17ClF2O5 and a molecular weight of 410.80 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7683916 |
| Molecular Formula | C20H17ClF2O5 |
| Molecular Weight | 410.80 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1c(Cl)cc(/C=C/C(=O)OCC(=O)c2ccc(F)c(F)c2)cc1OC |
| InChI | InChI=1S/C20H17ClF2O5/c1-3-27-20-14(21)8-12(9-18(20)26-2)4-7-19(25)28-11-17(24)13-5-6-15(22)16(23)10-13/h4-10H,3,11H2,1-2H3/b7-4+ |
| InChIKey | DHQUERONTMWOEO-QPJJXVBHSA-N |
| XLogP | 4.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.80 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|