C21H21ClO5S — CID 41146119
[2-(4-methylsulfanylphenyl)-2-oxoethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 41146119) has the molecular formula C21H21ClO5S and a molecular weight of 420.91 g/mol. Its IUPAC name is [2-(4-methylsulfanylphenyl)-2-oxoethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(4-methylsulfanylphenyl)-2-oxoethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 41146119 |
| Molecular Formula | C21H21ClO5S |
| Molecular Weight | 420.91 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | [2-(4-methylsulfanylphenyl)-2-oxoethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)OCC(=O)c2ccc(SC)cc2)cc(Cl)c1OC |
| InChI | InChI=1S/C21H21ClO5S/c1-4-26-19-12-14(11-17(22)21(19)25-2)5-10-20(24)27-13-18(23)15-6-8-16(28-3)9-7-15/h5-12H,4,13H2,1-3H3/b10-5+ |
| InChIKey | DFHOSIWVPLEYLK-BJMVGYQFSA-N |
| XLogP | 4.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.91 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|