C22H23ClO6 — CID 7683917
(5-acetyl-2-methoxyphenyl)methyl (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate (PubChem CID 7683917) has the molecular formula C22H23ClO6 and a molecular weight of 418.87 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7683917 |
| Molecular Formula | C22H23ClO6 |
| Molecular Weight | 418.87 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1c(Cl)cc(/C=C/C(=O)OCc2cc(C(C)=O)ccc2OC)cc1OC |
| InChI | InChI=1S/C22H23ClO6/c1-5-28-22-18(23)10-15(11-20(22)27-4)6-9-21(25)29-13-17-12-16(14(2)24)7-8-19(17)26-3/h6-12H,5,13H2,1-4H3/b9-6+ |
| InChIKey | HJZQQOHNXDAGNH-RMKNXTFCSA-N |
| XLogP | 4.72 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.87 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|