C20H19FO5 — CID 7550629
[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] (E)-3-(4-ethoxyphenyl)prop-2-enoate (PubChem CID 7550629) has the molecular formula C20H19FO5 and a molecular weight of 358.37 g/mol. Its IUPAC name is [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] (E)-3-(4-ethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] (E)-3-(4-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7550629 |
| Molecular Formula | C20H19FO5 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] (E)-3-(4-ethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(/C=C/C(=O)OCC(=O)c2ccc(OC)c(F)c2)cc1 |
| InChI | InChI=1S/C20H19FO5/c1-3-25-16-8-4-14(5-9-16)6-11-20(23)26-13-18(22)15-7-10-19(24-2)17(21)12-15/h4-12H,3,13H2,1-2H3/b11-6+ |
| InChIKey | XRPJHVPTSNODGP-IZZDOVSWSA-N |
| XLogP | 3.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|