C21H23FO6 — CID 7794956
3-(4-fluorophenoxy)propyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 7794956) has the molecular formula C21H23FO6 and a molecular weight of 390.41 g/mol. Its IUPAC name is 3-(4-fluorophenoxy)propyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | 3-(4-fluorophenoxy)propyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7794956 |
| Molecular Formula | C21H23FO6 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 3-(4-fluorophenoxy)propyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCCCOc2ccc(F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H23FO6/c1-24-18-13-15(14-19(25-2)21(18)26-3)5-10-20(23)28-12-4-11-27-17-8-6-16(22)7-9-17/h5-10,13-14H,4,11-12H2,1-3H3/b10-5+ |
| InChIKey | OGQMMSJHNLTROK-BJMVGYQFSA-N |
| XLogP | 3.88 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|