C37H45NO13 — CID 45103921
3-[3-[2,2-bis(4-methoxyphenyl)acetyl]oxypropyl-methylamino]propyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate;oxalic acid (PubChem CID 45103921) has the molecular formula C37H45NO13 and a molecular weight of 711.76 g/mol. Its IUPAC name is 3-[3-[2,2-bis(4-methoxyphenyl)acetyl]oxypropyl-methylamino]propyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate;oxalic acid.
| Compound Name | 3-[3-[2,2-bis(4-methoxyphenyl)acetyl]oxypropyl-methylamino]propyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate;oxalic acid |
|---|---|
| PubChem CID | 45103921 |
| Molecular Formula | C37H45NO13 |
| Molecular Weight | 711.76 g/mol |
| Exact Mass | 711.29 |
| IUPAC Name | 3-[3-[2,2-bis(4-methoxyphenyl)acetyl]oxypropyl-methylamino]propyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate;oxalic acid |
| SMILES | COc1ccc(C(C(=O)OCCCN(C)CCCOC(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)c2ccc(OC)cc2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C35H43NO9.C2H2O4/c1-36(19-7-21-44-32(37)18-9-25-23-30(41-4)34(43-6)31(24-25)42-5)20-8-22-45-35(38)33(26-10-14-28(39-2)15-11-26)27-12-16-29(40-3)17-13-27;3-1(4)2(5)6/h9-18,23-24,33H,7-8,19-22H2,1-6H3;(H,3,4)(H,5,6)/b18-9+; |
| InChIKey | QRPRDLIDFBEXTL-WUBZALIBSA-N |
| XLogP | 4.53 |
| TPSA | 176.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.76 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|