C23H42O7Si3 — CID 154327544
4-[bis(trimethylsilyloxy)methylsilyl]butyl 3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 154327544) has the molecular formula C23H42O7Si3 and a molecular weight of 514.84 g/mol. Its IUPAC name is 4-[bis(trimethylsilyloxy)methylsilyl]butyl 3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | 4-[bis(trimethylsilyloxy)methylsilyl]butyl 3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 154327544 |
| Molecular Formula | C23H42O7Si3 |
| Molecular Weight | 514.84 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 4-[bis(trimethylsilyloxy)methylsilyl]butyl 3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OCCCC[SiH2]C(O[Si](C)(C)C)O[Si](C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C23H42O7Si3/c1-25-19-16-18(17-20(26-2)22(19)27-3)12-13-21(24)28-14-10-11-15-31-23(29-32(4,5)6)30-33(7,8)9/h12-13,16-17,23H,10-11,14-15,31H2,1-9H3 |
| InChIKey | JDHOSFFXRUJPKK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.84 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|