C20H22O6S — CID 7794979
(4-oxo-4-thiophen-2-ylbutyl) (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 7794979) has the molecular formula C20H22O6S and a molecular weight of 390.46 g/mol. Its IUPAC name is (4-oxo-4-thiophen-2-ylbutyl) (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | (4-oxo-4-thiophen-2-ylbutyl) (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7794979 |
| Molecular Formula | C20H22O6S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (4-oxo-4-thiophen-2-ylbutyl) (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCCCC(=O)c2cccs2)cc(OC)c1OC |
| InChI | InChI=1S/C20H22O6S/c1-23-16-12-14(13-17(24-2)20(16)25-3)8-9-19(22)26-10-4-6-15(21)18-7-5-11-27-18/h5,7-9,11-13H,4,6,10H2,1-3H3/b9-8+ |
| InChIKey | STLNZARACYBWNY-CMDGGOBGSA-N |
| XLogP | 3.99 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|