C16H14O6S — CID 134123517
(E)-3-[3,5-dimethoxy-4-(thiophene-2-carbonyloxy)phenyl]prop-2-enoic acid (PubChem CID 134123517) has the molecular formula C16H14O6S and a molecular weight of 334.35 g/mol. Its IUPAC name is (E)-3-[3,5-dimethoxy-4-(thiophene-2-carbonyloxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-dimethoxy-4-(thiophene-2-carbonyloxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134123517 |
| Molecular Formula | C16H14O6S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | (E)-3-[3,5-dimethoxy-4-(thiophene-2-carbonyloxy)phenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)O)cc(OC)c1OC(=O)c1cccs1 |
| InChI | InChI=1S/C16H14O6S/c1-20-11-8-10(5-6-14(17)18)9-12(21-2)15(11)22-16(19)13-4-3-7-23-13/h3-9H,1-2H3,(H,17,18)/b6-5+ |
| InChIKey | OTVQHZNPQHTEIF-AATRIKPKSA-N |
| XLogP | 3.08 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|