C13H12O4S — CID 59558858
(2,4-dimethoxyphenyl) thiophene-2-carboxylate (PubChem CID 59558858) has the molecular formula C13H12O4S and a molecular weight of 264.30 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl) thiophene-2-carboxylate.
| Compound Name | (2,4-dimethoxyphenyl) thiophene-2-carboxylate |
|---|---|
| PubChem CID | 59558858 |
| Molecular Formula | C13H12O4S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | (2,4-dimethoxyphenyl) thiophene-2-carboxylate |
| SMILES | COc1ccc(OC(=O)c2cccs2)c(OC)c1 |
| InChI | InChI=1S/C13H12O4S/c1-15-9-5-6-10(11(8-9)16-2)17-13(14)12-4-3-7-18-12/h3-8H,1-2H3 |
| InChIKey | UJGURAWIBFXZOV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|