C14H15NO3S — CID 13176318
N-(3,4-dimethoxyphenyl)-N-methylthiophene-2-carboxamide (PubChem CID 13176318) has the molecular formula C14H15NO3S and a molecular weight of 277.35 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-N-methylthiophene-2-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 13176318 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-N-methylthiophene-2-carboxamide |
| SMILES | COc1ccc(N(C)C(=O)c2cccs2)cc1OC |
| InChI | InChI=1S/C14H15NO3S/c1-15(14(16)13-5-4-8-19-13)10-6-7-11(17-2)12(9-10)18-3/h4-9H,1-3H3 |
| InChIKey | VRUSMIVGGMSHIS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |