C14H14O4S — CID 93191545
thiophen-2-yl-(2,4,6-trimethoxyphenyl)methanone (PubChem CID 93191545) has the molecular formula C14H14O4S and a molecular weight of 278.33 g/mol. Its IUPAC name is thiophen-2-yl-(2,4,6-trimethoxyphenyl)methanone.
| Compound Name | thiophen-2-yl-(2,4,6-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 93191545 |
| Molecular Formula | C14H14O4S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | thiophen-2-yl-(2,4,6-trimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)c(C(=O)c2cccs2)c(OC)c1 |
| InChI | InChI=1S/C14H14O4S/c1-16-9-7-10(17-2)13(11(8-9)18-3)14(15)12-5-4-6-19-12/h4-8H,1-3H3 |
| InChIKey | KHPPIKHLUPNGAB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |