C15H15O7PS — CID 54276573
[3,5-dimethoxy-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] dihydrogen phosphate (PubChem CID 54276573) has the molecular formula C15H15O7PS and a molecular weight of 370.32 g/mol. Its IUPAC name is [3,5-dimethoxy-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] dihydrogen phosphate.
| Compound Name | [3,5-dimethoxy-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 54276573 |
| Molecular Formula | C15H15O7PS |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | [3,5-dimethoxy-2-(3-thiophen-2-ylprop-2-enoyl)phenyl] dihydrogen phosphate |
| SMILES | COc1cc(OC)c(C(=O)C=Cc2cccs2)c(OP(=O)(O)O)c1 |
| InChI | InChI=1S/C15H15O7PS/c1-20-10-8-13(21-2)15(14(9-10)22-23(17,18)19)12(16)6-5-11-4-3-7-24-11/h3-9H,1-2H3,(H2,17,18,19) |
| InChIKey | RNVAZNMRYDRPNT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|