C18H16F2O4 — CID 139593021
(E)-3-(3,5-difluorophenyl)-1-(2,4,6-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 139593021) has the molecular formula C18H16F2O4 and a molecular weight of 334.32 g/mol. Its IUPAC name is (E)-3-(3,5-difluorophenyl)-1-(2,4,6-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-difluorophenyl)-1-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139593021 |
| Molecular Formula | C18H16F2O4 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (E)-3-(3,5-difluorophenyl)-1-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(OC)c(C(=O)/C=C/c2cc(F)cc(F)c2)c(OC)c1 |
| InChI | InChI=1S/C18H16F2O4/c1-22-14-9-16(23-2)18(17(10-14)24-3)15(21)5-4-11-6-12(19)8-13(20)7-11/h4-10H,1-3H3/b5-4+ |
| InChIKey | GDNJZTFHMRDVMK-SNAWJCMRSA-N |
| XLogP | 3.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|