C11H12O5 — CID 7578619
2-oxo-2-(2,4,6-trimethoxyphenyl)acetaldehyde (PubChem CID 7578619) has the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. Its IUPAC name is 2-oxo-2-(2,4,6-trimethoxyphenyl)acetaldehyde.
| Compound Name | 2-oxo-2-(2,4,6-trimethoxyphenyl)acetaldehyde |
|---|---|
| PubChem CID | 7578619 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-oxo-2-(2,4,6-trimethoxyphenyl)acetaldehyde |
| SMILES | COc1cc(OC)c(C(=O)C=O)c(OC)c1 |
| InChI | InChI=1S/C11H12O5/c1-14-7-4-9(15-2)11(8(13)6-12)10(5-7)16-3/h4-6H,1-3H3 |
| InChIKey | MRFBWHFGXICSDA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|