C10H12O3S — CID 86747405
1-(2,4-dimethoxy-6-sulfanylphenyl)ethanone (PubChem CID 86747405) has the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. Its IUPAC name is 1-(2,4-dimethoxy-6-sulfanylphenyl)ethanone.
| Compound Name | 1-(2,4-dimethoxy-6-sulfanylphenyl)ethanone |
|---|---|
| PubChem CID | 86747405 |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 1-(2,4-dimethoxy-6-sulfanylphenyl)ethanone |
| SMILES | COc1cc(S)c(C(C)=O)c(OC)c1 |
| InChI | InChI=1S/C10H12O3S/c1-6(11)10-8(13-3)4-7(12-2)5-9(10)14/h4-5,14H,1-3H3 |
| InChIKey | NGHGSACCARXJSS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|