C10H11FO3 — CID 117287701
1-(4-fluoro-2,6-dimethoxyphenyl)ethanone (PubChem CID 117287701) has the molecular formula C10H11FO3 and a molecular weight of 198.19 g/mol. Its IUPAC name is 1-(4-fluoro-2,6-dimethoxyphenyl)ethanone.
| Compound Name | 1-(4-fluoro-2,6-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 117287701 |
| Molecular Formula | C10H11FO3 |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 1-(4-fluoro-2,6-dimethoxyphenyl)ethanone |
| SMILES | COc1cc(F)cc(OC)c1C(C)=O |
| InChI | InChI=1S/C10H11FO3/c1-6(12)10-8(13-2)4-7(11)5-9(10)14-3/h4-5H,1-3H3 |
| InChIKey | HMIBJGKRBBMFNP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |