C10H10BrFO3 — CID 84811157
1-(3-bromo-2-fluoro-4,6-dimethoxyphenyl)ethanone (PubChem CID 84811157) has the molecular formula C10H10BrFO3 and a molecular weight of 277.09 g/mol. Its IUPAC name is 1-(3-bromo-2-fluoro-4,6-dimethoxyphenyl)ethanone.
| Compound Name | 1-(3-bromo-2-fluoro-4,6-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 84811157 |
| Molecular Formula | C10H10BrFO3 |
| Molecular Weight | 277.09 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | 1-(3-bromo-2-fluoro-4,6-dimethoxyphenyl)ethanone |
| SMILES | COc1cc(OC)c(C(C)=O)c(F)c1Br |
| InChI | InChI=1S/C10H10BrFO3/c1-5(13)8-6(14-2)4-7(15-3)9(11)10(8)12/h4H,1-3H3 |
| InChIKey | VUGPFXSBLZPKKA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.09 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |