C19H22O5 — CID 54389353
bis(2,4-dimethoxy-6-methylphenyl)methanone (PubChem CID 54389353) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is bis(2,4-dimethoxy-6-methylphenyl)methanone.
| Compound Name | bis(2,4-dimethoxy-6-methylphenyl)methanone |
|---|---|
| PubChem CID | 54389353 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | bis(2,4-dimethoxy-6-methylphenyl)methanone |
| SMILES | COc1cc(C)c(C(=O)c2c(C)cc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C19H22O5/c1-11-7-13(21-3)9-15(23-5)17(11)19(20)18-12(2)8-14(22-4)10-16(18)24-6/h7-10H,1-6H3 |
| InChIKey | VFNFFAGDMWMUID-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |